C21H29FN2O4S — CID 145227582
3-[3-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpropoxymethyl]piperidine-2,6-dione (PubChem CID 145227582) has the molecular formula C21H29FN2O4S and a molecular weight of 424.54 g/mol. Its IUPAC name is 3-[3-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpropoxymethyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpropoxymethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 145227582 |
| Molecular Formula | C21H29FN2O4S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-[3-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpropoxymethyl]piperidine-2,6-dione |
| SMILES | CC(NSCCCOCC1CCC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H29FN2O4S/c1-14(16-5-7-18(22)19(11-16)28-12-15-3-4-15)24-29-10-2-9-27-13-17-6-8-20(25)23-21(17)26/h5,7,11,14-15,17,24H,2-4,6,8-10,12-13H2,1H3,(H,23,25,26) |
| InChIKey | DGAIVIOLNBNESB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|