C21H28FN3O3S — CID 162532082
5-[(E)-5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpent-3-enyl]-5-methylimidazolidine-2,4-dione (PubChem CID 162532082) has the molecular formula C21H28FN3O3S and a molecular weight of 421.54 g/mol. Its IUPAC name is 5-[(E)-5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpent-3-enyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[(E)-5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpent-3-enyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 162532082 |
| Molecular Formula | C21H28FN3O3S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 5-[(E)-5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpent-3-enyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC(NSC/C=C/CCC1(C)NC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H28FN3O3S/c1-14(16-8-9-17(22)18(12-16)28-13-15-6-7-15)25-29-11-5-3-4-10-21(2)19(26)23-20(27)24-21/h3,5,8-9,12,14-15,25H,4,6-7,10-11,13H2,1-2H3,(H2,23,24,26,27)/b5-3+ |
| InChIKey | WQGWFTWINJHAEA-HWKANZROSA-N |
| XLogP | 3.85 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|