C22H30FN3O5S — CID 134553899
N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-5-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]pentane-1-sulfonamide (PubChem CID 134553899) has the molecular formula C22H30FN3O5S and a molecular weight of 467.56 g/mol. Its IUPAC name is N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-5-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]pentane-1-sulfonamide.
| Compound Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-5-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 134553899 |
| Molecular Formula | C22H30FN3O5S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-5-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]pentane-1-sulfonamide |
| SMILES | C[C@@]1(CCCCCS(=O)(=O)NC2(c3ccc(F)c(OCC4CC4)c3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C22H30FN3O5S/c1-21(19(27)24-20(28)25-21)9-3-2-4-12-32(29,30)26-22(10-11-22)16-7-8-17(23)18(13-16)31-14-15-5-6-15/h7-8,13,15,26H,2-6,9-12,14H2,1H3,(H2,24,25,27,28)/t21-/m0/s1 |
| InChIKey | MQFXGEQQGWVIJH-NRFANRHFSA-N |
| XLogP | 2.68 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|