C23H32FN3O5S — CID 134541362
N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-5-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 134541362) has the molecular formula C23H32FN3O5S and a molecular weight of 481.59 g/mol. Its IUPAC name is N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-5-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-5-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 134541362 |
| Molecular Formula | C23H32FN3O5S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-5-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | CC1(C)C(=O)NC(=O)N1CCCCCS(=O)(=O)NC1(c2ccc(F)c(OCC3CC3)c2)CC1 |
| InChI | InChI=1S/C23H32FN3O5S/c1-22(2)20(28)25-21(29)27(22)12-4-3-5-13-33(30,31)26-23(10-11-23)17-8-9-18(24)19(14-17)32-15-16-6-7-16/h8-9,14,16,26H,3-7,10-13,15H2,1-2H3,(H,25,28,29) |
| InChIKey | VPVHQBKILYGMQJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|