C21H30FNO3S — CID 162462712
N-[1-[3-(cycloheptylmethoxy)-4-fluorophenyl]cyclopropyl]but-3-ene-1-sulfonamide (PubChem CID 162462712) has the molecular formula C21H30FNO3S and a molecular weight of 395.54 g/mol. Its IUPAC name is N-[1-[3-(cycloheptylmethoxy)-4-fluorophenyl]cyclopropyl]but-3-ene-1-sulfonamide.
| Compound Name | N-[1-[3-(cycloheptylmethoxy)-4-fluorophenyl]cyclopropyl]but-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 162462712 |
| Molecular Formula | C21H30FNO3S |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[1-[3-(cycloheptylmethoxy)-4-fluorophenyl]cyclopropyl]but-3-ene-1-sulfonamide |
| SMILES | C=CCCS(=O)(=O)NC1(c2ccc(F)c(OCC3CCCCCC3)c2)CC1 |
| InChI | InChI=1S/C21H30FNO3S/c1-2-3-14-27(24,25)23-21(12-13-21)18-10-11-19(22)20(15-18)26-16-17-8-6-4-5-7-9-17/h2,10-11,15,17,23H,1,3-9,12-14,16H2 |
| InChIKey | ICELRNFAWQJRHZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|