About (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide
(E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide (PubChem CID 135197981) has the molecular formula C19H28FNO3S
and a molecular weight of 369.50 g/mol. Its IUPAC name is (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide.
Molecular Properties
| Compound Name | (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide |
| PubChem CID | 135197981 |
| Molecular Formula | C19H28FNO3S |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide |
| SMILES | C/C=C/CCS(=O)(=O)NC1(c2ccc(F)c(OCC(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C19H28FNO3S/c1-5-6-7-12-25(22,23)21-19(10-11-19)15-8-9-16(20)17(13-15)24-14-18(2,3)4/h5-6,8-9,13,21H,7,10-12,14H2,1-4H3/b6-5+ |
| InChIKey | XSUJYZFPCUASLN-AATRIKPKSA-N |
| XLogP | 4.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide?
The IUPAC name of (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide (CID 135197981) is (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide.
What is the SMILES notation for (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide?
The canonical SMILES for (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide is C/C=C/CCS(=O)(=O)NC1(c2ccc(F)c(OCC(C)(C)C)c2)CC1.
What is the InChIKey of (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide?
The InChIKey is XSUJYZFPCUASLN-AATRIKPKSA-N. The full InChI is InChI=1S/C19H28FNO3S/c1-5-6-7-12-25(22,23)21-19(10-11-19)15-8-9-16(20)17(13-15)24-14-18(2,3)4/h5-6,8-9,13,21H,7,10-12,14H2,1-4H3/b6-5+.
What are the key properties of (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide?
(E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide has a molecular weight of 369.50 g/mol, XLogP of 4.13, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]pent-3-ene-1-sulfonamide is sourced from PubChem (CID 135197981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).