C18H27FN2O3S — CID 135218464
5-amino-N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]pentane-1-sulfonamide (PubChem CID 135218464) has the molecular formula C18H27FN2O3S and a molecular weight of 370.49 g/mol. Its IUPAC name is 5-amino-N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]pentane-1-sulfonamide.
| Compound Name | 5-amino-N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 135218464 |
| Molecular Formula | C18H27FN2O3S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 5-amino-N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]pentane-1-sulfonamide |
| SMILES | NCCCCCS(=O)(=O)NC1(c2ccc(F)c(OCC3CC3)c2)CC1 |
| InChI | InChI=1S/C18H27FN2O3S/c19-16-7-6-15(12-17(16)24-13-14-4-5-14)18(8-9-18)21-25(22,23)11-3-1-2-10-20/h6-7,12,14,21H,1-5,8-11,13,20H2 |
| InChIKey | ZKBDEHMSGIWELA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|