C18H29FN2O3S — CID 134542398
6-amino-N-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]hexane-1-sulfonamide (PubChem CID 134542398) has the molecular formula C18H29FN2O3S and a molecular weight of 372.51 g/mol. Its IUPAC name is 6-amino-N-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]hexane-1-sulfonamide.
| Compound Name | 6-amino-N-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]hexane-1-sulfonamide |
|---|---|
| PubChem CID | 134542398 |
| Molecular Formula | C18H29FN2O3S |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 6-amino-N-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]hexane-1-sulfonamide |
| SMILES | NCCCCCCS(=O)(=O)NCCc1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C18H29FN2O3S/c19-17-8-7-15(13-18(17)24-14-16-5-6-16)9-11-21-25(22,23)12-4-2-1-3-10-20/h7-8,13,16,21H,1-6,9-12,14,20H2 |
| InChIKey | KLLRKYRHPPXBKF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|