C20H29FN4OS2 — CID 162531995
2-amino-3-[5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpentyl]-4H-imidazole-5-thione (PubChem CID 162531995) has the molecular formula C20H29FN4OS2 and a molecular weight of 424.61 g/mol. Its IUPAC name is 2-amino-3-[5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpentyl]-4H-imidazole-5-thione.
| Compound Name | 2-amino-3-[5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpentyl]-4H-imidazole-5-thione |
|---|---|
| PubChem CID | 162531995 |
| Molecular Formula | C20H29FN4OS2 |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-amino-3-[5-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethylamino]sulfanylpentyl]-4H-imidazole-5-thione |
| SMILES | CC(NSCCCCCN1CC(=S)N=C1N)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C20H29FN4OS2/c1-14(16-7-8-17(21)18(11-16)26-13-15-5-6-15)24-28-10-4-2-3-9-25-12-19(27)23-20(25)22/h7-8,11,14-15,24H,2-6,9-10,12-13H2,1H3,(H2,22,23,27) |
| InChIKey | URLUSRFITXABRO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|