C18H27FN4O3S — CID 162532038
1-[5-[1-[5-(cyclopropylmethoxy)-4-fluoro-1H-pyrrol-2-yl]ethylamino]sulfanylpentyl]imidazolidine-2,4-dione (PubChem CID 162532038) has the molecular formula C18H27FN4O3S and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[5-[1-[5-(cyclopropylmethoxy)-4-fluoro-1H-pyrrol-2-yl]ethylamino]sulfanylpentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[1-[5-(cyclopropylmethoxy)-4-fluoro-1H-pyrrol-2-yl]ethylamino]sulfanylpentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 162532038 |
| Molecular Formula | C18H27FN4O3S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-[5-[1-[5-(cyclopropylmethoxy)-4-fluoro-1H-pyrrol-2-yl]ethylamino]sulfanylpentyl]imidazolidine-2,4-dione |
| SMILES | CC(NSCCCCCN1CC(=O)NC1=O)c1cc(F)c(OCC2CC2)[nH]1 |
| InChI | InChI=1S/C18H27FN4O3S/c1-12(15-9-14(19)17(20-15)26-11-13-5-6-13)22-27-8-4-2-3-7-23-10-16(24)21-18(23)25/h9,12-13,20,22H,2-8,10-11H2,1H3,(H,21,24,25) |
| InChIKey | PFNATPPLJCQEHU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|