C22H31FN2O5S — CID 157177623
1-[5-[(2R)-2-[5-(cyclopropylmethoxy)-2-fluoro-4-methylphenyl]propyl]sulfonylpentyl]imidazolidine-2,4-dione (PubChem CID 157177623) has the molecular formula C22H31FN2O5S and a molecular weight of 454.56 g/mol. Its IUPAC name is 1-[5-[(2R)-2-[5-(cyclopropylmethoxy)-2-fluoro-4-methylphenyl]propyl]sulfonylpentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[(2R)-2-[5-(cyclopropylmethoxy)-2-fluoro-4-methylphenyl]propyl]sulfonylpentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 157177623 |
| Molecular Formula | C22H31FN2O5S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-[5-[(2R)-2-[5-(cyclopropylmethoxy)-2-fluoro-4-methylphenyl]propyl]sulfonylpentyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(F)c([C@@H](C)CS(=O)(=O)CCCCCN2CC(=O)NC2=O)cc1OCC1CC1 |
| InChI | InChI=1S/C22H31FN2O5S/c1-15-10-19(23)18(11-20(15)30-13-17-6-7-17)16(2)14-31(28,29)9-5-3-4-8-25-12-21(26)24-22(25)27/h10-11,16-17H,3-9,12-14H2,1-2H3,(H,24,26,27)/t16-/m0/s1 |
| InChIKey | AOEVASILXOZHKC-INIZCTEOSA-N |
| XLogP | 3.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|