C21H31FN2O6S — CID 146793627
1-[5-[(2R)-2-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]propyl]sulfonylpentyl]imidazolidine-2,4-dione (PubChem CID 146793627) has the molecular formula C21H31FN2O6S and a molecular weight of 458.55 g/mol. Its IUPAC name is 1-[5-[(2R)-2-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]propyl]sulfonylpentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[(2R)-2-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]propyl]sulfonylpentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146793627 |
| Molecular Formula | C21H31FN2O6S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 1-[5-[(2R)-2-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]propyl]sulfonylpentyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H](CS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1ccc(F)c(OCC(C)(C)O)c1 |
| InChI | InChI=1S/C21H31FN2O6S/c1-15(16-7-8-17(22)18(11-16)30-14-21(2,3)27)13-31(28,29)10-6-4-5-9-24-12-19(25)23-20(24)26/h7-8,11,15,27H,4-6,9-10,12-14H2,1-3H3,(H,23,25,26)/t15-/m0/s1 |
| InChIKey | RWHWZERJGSIOST-HNNXBMFYSA-N |
| XLogP | 2.22 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|