C21H30N2O6S — CID 147856409
1-[(E)-5-[(2R)-2-[3-(2-hydroxy-2-methylpropoxy)phenyl]propyl]sulfonylpent-2-enyl]imidazolidine-2,4-dione (PubChem CID 147856409) has the molecular formula C21H30N2O6S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-[(E)-5-[(2R)-2-[3-(2-hydroxy-2-methylpropoxy)phenyl]propyl]sulfonylpent-2-enyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-5-[(2R)-2-[3-(2-hydroxy-2-methylpropoxy)phenyl]propyl]sulfonylpent-2-enyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 147856409 |
| Molecular Formula | C21H30N2O6S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-[(E)-5-[(2R)-2-[3-(2-hydroxy-2-methylpropoxy)phenyl]propyl]sulfonylpent-2-enyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H](CS(=O)(=O)CC/C=C/CN1CC(=O)NC1=O)c1cccc(OCC(C)(C)O)c1 |
| InChI | InChI=1S/C21H30N2O6S/c1-16(17-8-7-9-18(12-17)29-15-21(2,3)26)14-30(27,28)11-6-4-5-10-23-13-19(24)22-20(23)25/h4-5,7-9,12,16,26H,6,10-11,13-15H2,1-3H3,(H,22,24,25)/b5-4+/t16-/m0/s1 |
| InChIKey | HVVBSRZOUMGCKL-APHBUQMISA-N |
| XLogP | 1.85 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|