C20H28FN3O6S — CID 170116440
(E)-4-(2,4-dioxoimidazolidin-1-yl)-N-[(2S)-2-[3-(2-fluoropropoxy)phenyl]-2-hydroxybutyl]but-2-ene-1-sulfonamide (PubChem CID 170116440) has the molecular formula C20H28FN3O6S and a molecular weight of 457.52 g/mol. Its IUPAC name is (E)-4-(2,4-dioxoimidazolidin-1-yl)-N-[(2S)-2-[3-(2-fluoropropoxy)phenyl]-2-hydroxybutyl]but-2-ene-1-sulfonamide.
| Compound Name | (E)-4-(2,4-dioxoimidazolidin-1-yl)-N-[(2S)-2-[3-(2-fluoropropoxy)phenyl]-2-hydroxybutyl]but-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 170116440 |
| Molecular Formula | C20H28FN3O6S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (E)-4-(2,4-dioxoimidazolidin-1-yl)-N-[(2S)-2-[3-(2-fluoropropoxy)phenyl]-2-hydroxybutyl]but-2-ene-1-sulfonamide |
| SMILES | CC[C@@](O)(CNS(=O)(=O)C/C=C/CN1CC(=O)NC1=O)c1cccc(OCC(C)F)c1 |
| InChI | InChI=1S/C20H28FN3O6S/c1-3-20(27,16-7-6-8-17(11-16)30-13-15(2)21)14-22-31(28,29)10-5-4-9-24-12-18(25)23-19(24)26/h4-8,11,15,22,27H,3,9-10,12-14H2,1-2H3,(H,23,25,26)/b5-4+/t15?,20-/m1/s1 |
| InChIKey | CLEKUOJERLTCGN-XLXCGJAQSA-N |
| XLogP | 1.05 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|