C19H29F2NO4S — CID 146352986
(E)-N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhex-2-ene-1-sulfonamide (PubChem CID 146352986) has the molecular formula C19H29F2NO4S and a molecular weight of 405.51 g/mol. Its IUPAC name is (E)-N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhex-2-ene-1-sulfonamide.
| Compound Name | (E)-N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhex-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 146352986 |
| Molecular Formula | C19H29F2NO4S |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (E)-N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhex-2-ene-1-sulfonamide |
| SMILES | CC[C@@](O)(CNS(=O)(=O)C/C=C/CC(C)C)c1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C19H29F2NO4S/c1-4-19(23,14-22-27(24,25)11-6-5-8-15(2)3)16-9-7-10-17(12-16)26-13-18(20)21/h5-7,9-10,12,15,18,22-23H,4,8,11,13-14H2,1-3H3/b6-5+/t19-/m1/s1 |
| InChIKey | NSTNPMAOXGESOC-ZMBJWTFHSA-N |
| XLogP | 3.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|