C9H9F2NO2 — CID 168653985
N-[3-(2,2-difluoroethoxy)phenyl]formamide (PubChem CID 168653985) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)phenyl]formamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)phenyl]formamide |
|---|---|
| PubChem CID | 168653985 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)phenyl]formamide |
| SMILES | O=CNc1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C9H9F2NO2/c10-9(11)5-14-8-3-1-2-7(4-8)12-6-13/h1-4,6,9H,5H2,(H,12,13) |
| InChIKey | PEUHGPQWPGGJHH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|