2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid

C11H10F2O5 — CID 151482458

IUPAC2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid
SMILESO=C(O)C(C(=O)O)c1cccc(OCC(F)F)c1
InChIInChI=1S/C11H10F2O5/c12-8(13)5-18-7-3-1-2-6(4-7)9(10(14)15)11(16)17/h1-4,8-9H,5H2,(H,14,15)(H,16,17)
InChIKeyPMTKMJISNWMQDN-UHFFFAOYSA-N
MW260.19 g/mol
LogP1.58
Rot. Bonds6

About 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid

2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid (PubChem CID 151482458) has the molecular formula C11H10F2O5 and a molecular weight of 260.19 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid.

Molecular Properties

Compound Name2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid
PubChem CID151482458
Molecular FormulaC11H10F2O5
Molecular Weight260.19 g/mol
Exact Mass260.05
IUPAC Name2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid
SMILESO=C(O)C(C(=O)O)c1cccc(OCC(F)F)c1
InChIInChI=1S/C11H10F2O5/c12-8(13)5-18-7-3-1-2-6(4-7)9(10(14)15)11(16)17/h1-4,8-9H,5H2,(H,14,15)(H,16,17)
InChIKeyPMTKMJISNWMQDN-UHFFFAOYSA-N
XLogP1.58
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.19
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid?
The IUPAC name of 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid (CID 151482458) is 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid.
What is the SMILES notation for 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid?
The canonical SMILES for 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid is O=C(O)C(C(=O)O)c1cccc(OCC(F)F)c1.
What is the InChIKey of 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid?
The InChIKey is PMTKMJISNWMQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2O5/c12-8(13)5-18-7-3-1-2-6(4-7)9(10(14)15)11(16)17/h1-4,8-9H,5H2,(H,14,15)(H,16,17).
What are the key properties of 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid?
2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid has a molecular weight of 260.19 g/mol, XLogP of 1.58, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,2-difluoroethoxy)phenyl]propanedioic acid is sourced from PubChem (CID 151482458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).