C16H24O3 — CID 125468008
(2R,3R)-2-methyl-3-[3-(2-methylpropoxy)phenyl]pentanoic acid (PubChem CID 125468008) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-[3-(2-methylpropoxy)phenyl]pentanoic acid.
| Compound Name | (2R,3R)-2-methyl-3-[3-(2-methylpropoxy)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 125468008 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2R,3R)-2-methyl-3-[3-(2-methylpropoxy)phenyl]pentanoic acid |
| SMILES | CC[C@@H](c1cccc(OCC(C)C)c1)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C16H24O3/c1-5-15(12(4)16(17)18)13-7-6-8-14(9-13)19-10-11(2)3/h6-9,11-12,15H,5,10H2,1-4H3,(H,17,18)/t12-,15-/m1/s1 |
| InChIKey | SQZGGIHNSXQGKT-IUODEOHRSA-N |
| XLogP | 3.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |