C17H26O3 — CID 125467953
(2R,3R)-2-methyl-3-(3-pentoxyphenyl)pentanoic acid (PubChem CID 125467953) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-(3-pentoxyphenyl)pentanoic acid.
| Compound Name | (2R,3R)-2-methyl-3-(3-pentoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 125467953 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (2R,3R)-2-methyl-3-(3-pentoxyphenyl)pentanoic acid |
| SMILES | CCCCCOc1cccc([C@H](CC)[C@@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C17H26O3/c1-4-6-7-11-20-15-10-8-9-14(12-15)16(5-2)13(3)17(18)19/h8-10,12-13,16H,4-7,11H2,1-3H3,(H,18,19)/t13-,16-/m1/s1 |
| InChIKey | MJQRTPPQSIQVBL-CZUORRHYSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|