C10H14ClF2NO — CID 131801467
1-[3-(2,2-difluoroethoxy)phenyl]ethanamine;hydrochloride (PubChem CID 131801467) has the molecular formula C10H14ClF2NO and a molecular weight of 237.68 g/mol. Its IUPAC name is 1-[3-(2,2-difluoroethoxy)phenyl]ethanamine;hydrochloride.
| Compound Name | 1-[3-(2,2-difluoroethoxy)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 131801467 |
| Molecular Formula | C10H14ClF2NO |
| Molecular Weight | 237.68 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 1-[3-(2,2-difluoroethoxy)phenyl]ethanamine;hydrochloride |
| SMILES | CC(N)c1cccc(OCC(F)F)c1.Cl |
| InChI | InChI=1S/C10H13F2NO.ClH/c1-7(13)8-3-2-4-9(5-8)14-6-10(11)12;/h2-5,7,10H,6,13H2,1H3;1H |
| InChIKey | ISYWFEZOUZILQG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.68 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |