About N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide
N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide (PubChem CID 146352984) has the molecular formula C19H31F2NO4S
and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide |
| PubChem CID | 146352984 |
| Molecular Formula | C19H31F2NO4S |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide |
| SMILES | CC[C@@](O)(CNS(=O)(=O)CCCCC(C)C)c1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C19H31F2NO4S/c1-4-19(23,14-22-27(24,25)11-6-5-8-15(2)3)16-9-7-10-17(12-16)26-13-18(20)21/h7,9-10,12,15,18,22-23H,4-6,8,11,13-14H2,1-3H3/t19-/m1/s1 |
| InChIKey | IYGJHQJEVAEZOH-LJQANCHMSA-N |
| XLogP | 3.67 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide?
The IUPAC name of N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide (CID 146352984) is N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide.
What is the SMILES notation for N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide?
The canonical SMILES for N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide is CC[C@@](O)(CNS(=O)(=O)CCCCC(C)C)c1cccc(OCC(F)F)c1.
What is the InChIKey of N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide?
The InChIKey is IYGJHQJEVAEZOH-LJQANCHMSA-N. The full InChI is InChI=1S/C19H31F2NO4S/c1-4-19(23,14-22-27(24,25)11-6-5-8-15(2)3)16-9-7-10-17(12-16)26-13-18(20)21/h7,9-10,12,15,18,22-23H,4-6,8,11,13-14H2,1-3H3/t19-/m1/s1.
What are the key properties of N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide?
N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide has a molecular weight of 407.52 g/mol, XLogP of 3.67, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2-[3-(2,2-difluoroethoxy)phenyl]-2-hydroxybutyl]-5-methylhexane-1-sulfonamide is sourced from PubChem (CID 146352984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).