C19H30O2 — CID 54347923
1-(2,7-dimethyloctoxy)-3-(1-methoxyethenyl)benzene (PubChem CID 54347923) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-(2,7-dimethyloctoxy)-3-(1-methoxyethenyl)benzene.
| Compound Name | 1-(2,7-dimethyloctoxy)-3-(1-methoxyethenyl)benzene |
|---|---|
| PubChem CID | 54347923 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-(2,7-dimethyloctoxy)-3-(1-methoxyethenyl)benzene |
| SMILES | C=C(OC)c1cccc(OCC(C)CCCCC(C)C)c1 |
| InChI | InChI=1S/C19H30O2/c1-15(2)9-6-7-10-16(3)14-21-19-12-8-11-18(13-19)17(4)20-5/h8,11-13,15-16H,4,6-7,9-10,14H2,1-3,5H3 |
| InChIKey | PITXJTFQVKWAFV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|