C24H32O — CID 54179192
1-(3,7-dimethyloctoxy)-3-(1-phenylethenyl)benzene (PubChem CID 54179192) has the molecular formula C24H32O and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-(3,7-dimethyloctoxy)-3-(1-phenylethenyl)benzene.
| Compound Name | 1-(3,7-dimethyloctoxy)-3-(1-phenylethenyl)benzene |
|---|---|
| PubChem CID | 54179192 |
| Molecular Formula | C24H32O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-(3,7-dimethyloctoxy)-3-(1-phenylethenyl)benzene |
| SMILES | C=C(c1ccccc1)c1cccc(OCCC(C)CCCC(C)C)c1 |
| InChI | InChI=1S/C24H32O/c1-19(2)10-8-11-20(3)16-17-25-24-15-9-14-23(18-24)21(4)22-12-6-5-7-13-22/h5-7,9,12-15,18-20H,4,8,10-11,16-17H2,1-3H3 |
| InChIKey | IQXGIGREPMIGOB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |