C33H51ClO2 — CID 141321336
[2-chloro-5-(3,7,11,15-tetramethylhexadecoxy)phenyl]-phenylmethanol (PubChem CID 141321336) has the molecular formula C33H51ClO2 and a molecular weight of 515.22 g/mol. Its IUPAC name is [2-chloro-5-(3,7,11,15-tetramethylhexadecoxy)phenyl]-phenylmethanol.
| Compound Name | [2-chloro-5-(3,7,11,15-tetramethylhexadecoxy)phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 141321336 |
| Molecular Formula | C33H51ClO2 |
| Molecular Weight | 515.22 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | [2-chloro-5-(3,7,11,15-tetramethylhexadecoxy)phenyl]-phenylmethanol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOc1ccc(Cl)c(C(O)c2ccccc2)c1 |
| InChI | InChI=1S/C33H51ClO2/c1-25(2)12-9-13-26(3)14-10-15-27(4)16-11-17-28(5)22-23-36-30-20-21-32(34)31(24-30)33(35)29-18-7-6-8-19-29/h6-8,18-21,24-28,33,35H,9-17,22-23H2,1-5H3 |
| InChIKey | YAUNAWOABDRELW-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.22 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |