C23H32O2 — CID 141001120
1-(3,7-dimethyloctoxy)-3-(4-methoxyphenyl)benzene (PubChem CID 141001120) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 1-(3,7-dimethyloctoxy)-3-(4-methoxyphenyl)benzene.
| Compound Name | 1-(3,7-dimethyloctoxy)-3-(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 141001120 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-(3,7-dimethyloctoxy)-3-(4-methoxyphenyl)benzene |
| SMILES | COc1ccc(-c2cccc(OCCC(C)CCCC(C)C)c2)cc1 |
| InChI | InChI=1S/C23H32O2/c1-18(2)7-5-8-19(3)15-16-25-23-10-6-9-21(17-23)20-11-13-22(24-4)14-12-20/h6,9-14,17-19H,5,7-8,15-16H2,1-4H3 |
| InChIKey | UHRHYUDAPNIEDT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |