C34H50Br2O2 — CID 87315909
1-[1,2-dibromo-2-[3-(3,7-dimethyloctoxy)phenyl]ethenyl]-3-(3,7-dimethyloctoxy)benzene (PubChem CID 87315909) has the molecular formula C34H50Br2O2 and a molecular weight of 650.58 g/mol. Its IUPAC name is 1-[1,2-dibromo-2-[3-(3,7-dimethyloctoxy)phenyl]ethenyl]-3-(3,7-dimethyloctoxy)benzene.
| Compound Name | 1-[1,2-dibromo-2-[3-(3,7-dimethyloctoxy)phenyl]ethenyl]-3-(3,7-dimethyloctoxy)benzene |
|---|---|
| PubChem CID | 87315909 |
| Molecular Formula | C34H50Br2O2 |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 1-[1,2-dibromo-2-[3-(3,7-dimethyloctoxy)phenyl]ethenyl]-3-(3,7-dimethyloctoxy)benzene |
| SMILES | CC(C)CCCC(C)CCOc1cccc(C(Br)=C(Br)c2cccc(OCCC(C)CCCC(C)C)c2)c1 |
| InChI | InChI=1S/C34H50Br2O2/c1-25(2)11-7-13-27(5)19-21-37-31-17-9-15-29(23-31)33(35)34(36)30-16-10-18-32(24-30)38-22-20-28(6)14-8-12-26(3)4/h9-10,15-18,23-28H,7-8,11-14,19-22H2,1-6H3 |
| InChIKey | CRNGRRUNRKFEQT-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|