C30H52N2O2 — CID 23393099
4-methyl-1-[3-(3,7,11,15-tetramethylhexadecoxy)phenyl]pyrazolidin-3-one (PubChem CID 23393099) has the molecular formula C30H52N2O2 and a molecular weight of 472.76 g/mol. Its IUPAC name is 4-methyl-1-[3-(3,7,11,15-tetramethylhexadecoxy)phenyl]pyrazolidin-3-one.
| Compound Name | 4-methyl-1-[3-(3,7,11,15-tetramethylhexadecoxy)phenyl]pyrazolidin-3-one |
|---|---|
| PubChem CID | 23393099 |
| Molecular Formula | C30H52N2O2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.40 |
| IUPAC Name | 4-methyl-1-[3-(3,7,11,15-tetramethylhexadecoxy)phenyl]pyrazolidin-3-one |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOc1cccc(N2CC(C)C(=O)N2)c1 |
| InChI | InChI=1S/C30H52N2O2/c1-23(2)11-7-12-24(3)13-8-14-25(4)15-9-16-26(5)19-20-34-29-18-10-17-28(21-29)32-22-27(6)30(33)31-32/h10,17-18,21,23-27H,7-9,11-16,19-20,22H2,1-6H3,(H,31,33) |
| InChIKey | RHQUICWHRPRFFS-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |