C27H48O2 — CID 141321330
1-methoxy-3-(3,7,11,15-tetramethylhexadecoxy)benzene (PubChem CID 141321330) has the molecular formula C27H48O2 and a molecular weight of 404.68 g/mol. Its IUPAC name is 1-methoxy-3-(3,7,11,15-tetramethylhexadecoxy)benzene.
| Compound Name | 1-methoxy-3-(3,7,11,15-tetramethylhexadecoxy)benzene |
|---|---|
| PubChem CID | 141321330 |
| Molecular Formula | C27H48O2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.37 |
| IUPAC Name | 1-methoxy-3-(3,7,11,15-tetramethylhexadecoxy)benzene |
| SMILES | COc1cccc(OCCC(C)CCCC(C)CCCC(C)CCCC(C)C)c1 |
| InChI | InChI=1S/C27H48O2/c1-22(2)11-7-12-23(3)13-8-14-24(4)15-9-16-25(5)19-20-29-27-18-10-17-26(21-27)28-6/h10,17-18,21-25H,7-9,11-16,19-20H2,1-6H3 |
| InChIKey | VJJCVECZIHNMEE-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |