C24H32Br2O2 — CID 101223776
1,4-bis(bromomethyl)-2-[3-(3,7-dimethyloctoxy)phenoxy]benzene (PubChem CID 101223776) has the molecular formula C24H32Br2O2 and a molecular weight of 512.33 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)-2-[3-(3,7-dimethyloctoxy)phenoxy]benzene.
| Compound Name | 1,4-bis(bromomethyl)-2-[3-(3,7-dimethyloctoxy)phenoxy]benzene |
|---|---|
| PubChem CID | 101223776 |
| Molecular Formula | C24H32Br2O2 |
| Molecular Weight | 512.33 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 1,4-bis(bromomethyl)-2-[3-(3,7-dimethyloctoxy)phenoxy]benzene |
| SMILES | CC(C)CCCC(C)CCOc1cccc(Oc2cc(CBr)ccc2CBr)c1 |
| InChI | InChI=1S/C24H32Br2O2/c1-18(2)6-4-7-19(3)12-13-27-22-8-5-9-23(15-22)28-24-14-20(16-25)10-11-21(24)17-26/h5,8-11,14-15,18-19H,4,6-7,12-13,16-17H2,1-3H3 |
| InChIKey | RWUULCLSLNDFLF-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.33 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|