C24H36OP2 — CID 88589671
[3-[4-(3,7-dimethyloctoxy)phenyl]-4-(phosphanylmethyl)phenyl]-methylphosphane (PubChem CID 88589671) has the molecular formula C24H36OP2 and a molecular weight of 402.50 g/mol. Its IUPAC name is [3-[4-(3,7-dimethyloctoxy)phenyl]-4-(phosphanylmethyl)phenyl]-methylphosphane.
| Compound Name | [3-[4-(3,7-dimethyloctoxy)phenyl]-4-(phosphanylmethyl)phenyl]-methylphosphane |
|---|---|
| PubChem CID | 88589671 |
| Molecular Formula | C24H36OP2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [3-[4-(3,7-dimethyloctoxy)phenyl]-4-(phosphanylmethyl)phenyl]-methylphosphane |
| SMILES | CPc1ccc(CP)c(-c2ccc(OCCC(C)CCCC(C)C)cc2)c1 |
| InChI | InChI=1S/C24H36OP2/c1-18(2)6-5-7-19(3)14-15-25-22-11-8-20(9-12-22)24-16-23(27-4)13-10-21(24)17-26/h8-13,16,18-19,27H,5-7,14-15,17,26H2,1-4H3 |
| InChIKey | ZAFBSTBRVFYIPT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|