C41H50O — CID 162767507
1-[4-[4-[(3S)-3,7-dimethyloctoxy]phenyl]phenyl]-9,9-dipropylfluorene (PubChem CID 162767507) has the molecular formula C41H50O and a molecular weight of 558.85 g/mol. Its IUPAC name is 1-[4-[4-[(3S)-3,7-dimethyloctoxy]phenyl]phenyl]-9,9-dipropylfluorene.
| Compound Name | 1-[4-[4-[(3S)-3,7-dimethyloctoxy]phenyl]phenyl]-9,9-dipropylfluorene |
|---|---|
| PubChem CID | 162767507 |
| Molecular Formula | C41H50O |
| Molecular Weight | 558.85 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | 1-[4-[4-[(3S)-3,7-dimethyloctoxy]phenyl]phenyl]-9,9-dipropylfluorene |
| SMILES | CCCC1(CCC)c2ccccc2-c2cccc(-c3ccc(-c4ccc(OCC[C@@H](C)CCCC(C)C)cc4)cc3)c21 |
| InChI | InChI=1S/C41H50O/c1-6-27-41(28-7-2)39-17-9-8-14-37(39)38-16-11-15-36(40(38)41)34-20-18-32(19-21-34)33-22-24-35(25-23-33)42-29-26-31(5)13-10-12-30(3)4/h8-9,11,14-25,30-31H,6-7,10,12-13,26-29H2,1-5H3/t31-/m0/s1 |
| InChIKey | LJJOAIAIQSYOSL-HKBQPEDESA-N |
| XLogP | 12.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.85 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |