C17H25NO — CID 102039293
1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene (PubChem CID 102039293) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene.
| Compound Name | 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene |
|---|---|
| PubChem CID | 102039293 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene |
| SMILES | [C-]#[N+]c1ccc(OCC[C@@H](C)CCCC(C)C)cc1 |
| InChI | InChI=1S/C17H25NO/c1-14(2)6-5-7-15(3)12-13-19-17-10-8-16(18-4)9-11-17/h8-11,14-15H,5-7,12-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | ZKJCTDUDAHUHPE-HNNXBMFYSA-N |
| XLogP | 5.47 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|