About 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene
1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene (PubChem CID 102039293) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene.
Molecular Properties
| Compound Name | 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene |
| PubChem CID | 102039293 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene |
| SMILES | [C-]#[N+]c1ccc(OCC[C@@H](C)CCCC(C)C)cc1 |
| InChI | InChI=1S/C17H25NO/c1-14(2)6-5-7-15(3)12-13-19-17-10-8-16(18-4)9-11-17/h8-11,14-15H,5-7,12-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | ZKJCTDUDAHUHPE-HNNXBMFYSA-N |
| XLogP | 5.47 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene?
The IUPAC name of 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene (CID 102039293) is 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene.
What is the SMILES notation for 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene?
The canonical SMILES for 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene is [C-]#[N+]c1ccc(OCC[C@@H](C)CCCC(C)C)cc1.
What is the InChIKey of 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene?
The InChIKey is ZKJCTDUDAHUHPE-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H25NO/c1-14(2)6-5-7-15(3)12-13-19-17-10-8-16(18-4)9-11-17/h8-11,14-15H,5-7,12-13H2,1-3H3/t15-/m0/s1.
What are the key properties of 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene?
1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene has a molecular weight of 259.39 g/mol, XLogP of 5.47, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3,7-dimethyloctoxy]-4-isocyanobenzene is sourced from PubChem (CID 102039293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).