C23H35N3O3 — CID 134559070
1-[(E)-7-[[(1R)-1-[3-(2-methylpropoxy)phenyl]ethyl]amino]hept-2-enyl]-1,3-diazinane-2,4-dione (PubChem CID 134559070) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is 1-[(E)-7-[[(1R)-1-[3-(2-methylpropoxy)phenyl]ethyl]amino]hept-2-enyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(E)-7-[[(1R)-1-[3-(2-methylpropoxy)phenyl]ethyl]amino]hept-2-enyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 134559070 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 1-[(E)-7-[[(1R)-1-[3-(2-methylpropoxy)phenyl]ethyl]amino]hept-2-enyl]-1,3-diazinane-2,4-dione |
| SMILES | CC(C)COc1cccc([C@@H](C)NCCCC/C=C/CN2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C23H35N3O3/c1-18(2)17-29-21-11-9-10-20(16-21)19(3)24-13-7-5-4-6-8-14-26-15-12-22(27)25-23(26)28/h6,8-11,16,18-19,24H,4-5,7,12-15,17H2,1-3H3,(H,25,27,28)/b8-6+/t19-/m1/s1 |
| InChIKey | IKARVDSNXQPRBK-ZLQZBKBYSA-N |
| XLogP | 4.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|