C24H34N2O5S — CID 148929930
1-[(E)-5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pent-2-enyl]-1,3-diazinane-2,4-dione (PubChem CID 148929930) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is 1-[(E)-5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pent-2-enyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(E)-5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pent-2-enyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 148929930 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-[(E)-5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pent-2-enyl]-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(C)COc1cccc(C2(CS(=O)(=O)CC/C=C/CN3CCC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C24H34N2O5S/c1-23(2,3)17-31-20-9-7-8-19(16-20)24(11-12-24)18-32(29,30)15-6-4-5-13-26-14-10-21(27)25-22(26)28/h4-5,7-9,16H,6,10-15,17-18H2,1-3H3,(H,25,27,28)/b5-4+ |
| InChIKey | PLSXSIFABFEYLA-SNAWJCMRSA-N |
| XLogP | 3.45 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|