C22H33N3O3S — CID 145227565
1-[(E)-5-[[(1R)-1-[3-(2,2-dimethylpropoxy)phenyl]ethyl]amino]sulfanylpent-2-enyl]-1,3-diazinane-2,4-dione (PubChem CID 145227565) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-[(E)-5-[[(1R)-1-[3-(2,2-dimethylpropoxy)phenyl]ethyl]amino]sulfanylpent-2-enyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(E)-5-[[(1R)-1-[3-(2,2-dimethylpropoxy)phenyl]ethyl]amino]sulfanylpent-2-enyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 145227565 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[(E)-5-[[(1R)-1-[3-(2,2-dimethylpropoxy)phenyl]ethyl]amino]sulfanylpent-2-enyl]-1,3-diazinane-2,4-dione |
| SMILES | C[C@@H](NSCC/C=C/CN1CCC(=O)NC1=O)c1cccc(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C22H33N3O3S/c1-17(18-9-8-10-19(15-18)28-16-22(2,3)4)24-29-14-7-5-6-12-25-13-11-20(26)23-21(25)27/h5-6,8-10,15,17,24H,7,11-14,16H2,1-4H3,(H,23,26,27)/b6-5+/t17-/m1/s1 |
| InChIKey | QQOPVVBOZFTXRC-FUTAKVPZSA-N |
| XLogP | 4.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|