C17H26N4O2 — CID 142360603
1-[5-[2-(1-phenylethyl)hydrazinyl]pentyl]-1,3-diazinane-2,4-dione (PubChem CID 142360603) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[5-[2-(1-phenylethyl)hydrazinyl]pentyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[5-[2-(1-phenylethyl)hydrazinyl]pentyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 142360603 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[5-[2-(1-phenylethyl)hydrazinyl]pentyl]-1,3-diazinane-2,4-dione |
| SMILES | CC(NNCCCCCN1CCC(=O)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C17H26N4O2/c1-14(15-8-4-2-5-9-15)20-18-11-6-3-7-12-21-13-10-16(22)19-17(21)23/h2,4-5,8-9,14,18,20H,3,6-7,10-13H2,1H3,(H,19,22,23) |
| InChIKey | UKRLILDLKAAFKS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|