C22H34FN3O5S — CID 135378815
N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]ethyl]-5-(2,4-dioxo-1,3-diazinan-1-yl)pentane-1-sulfonamide (PubChem CID 135378815) has the molecular formula C22H34FN3O5S and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]ethyl]-5-(2,4-dioxo-1,3-diazinan-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]ethyl]-5-(2,4-dioxo-1,3-diazinan-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 135378815 |
| Molecular Formula | C22H34FN3O5S |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]ethyl]-5-(2,4-dioxo-1,3-diazinan-1-yl)pentane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCCCN1CCC(=O)NC1=O)c1ccc(F)c(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C22H34FN3O5S/c1-16(17-8-9-18(23)19(14-17)31-15-22(2,3)4)25-32(29,30)13-7-5-6-11-26-12-10-20(27)24-21(26)28/h8-9,14,16,25H,5-7,10-13,15H2,1-4H3,(H,24,27,28) |
| InChIKey | GZIAOQHTANMSNV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|