C10H17N3O4 — CID 101112605
(2S)-2-amino-6-(2,4-dioxo-1,3-diazinan-1-yl)hexanoic acid (PubChem CID 101112605) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is (2S)-2-amino-6-(2,4-dioxo-1,3-diazinan-1-yl)hexanoic acid.
| Compound Name | (2S)-2-amino-6-(2,4-dioxo-1,3-diazinan-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 101112605 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | (2S)-2-amino-6-(2,4-dioxo-1,3-diazinan-1-yl)hexanoic acid |
| SMILES | N[C@@H](CCCCN1CCC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C10H17N3O4/c11-7(9(15)16)3-1-2-5-13-6-4-8(14)12-10(13)17/h7H,1-6,11H2,(H,15,16)(H,12,14,17)/t7-/m0/s1 |
| InChIKey | DSJURQOHSWRCSF-ZETCQYMHSA-N |
| XLogP | -0.49 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|