C9H20N4O3 — CID 70503215
(2S)-2,6-diaminohexanoic acid;pyrazolidin-3-one (PubChem CID 70503215) has the molecular formula C9H20N4O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;pyrazolidin-3-one.
| Compound Name | (2S)-2,6-diaminohexanoic acid;pyrazolidin-3-one |
|---|---|
| PubChem CID | 70503215 |
| Molecular Formula | C9H20N4O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;pyrazolidin-3-one |
| SMILES | NCCCC[C@H](N)C(=O)O.O=C1CCNN1 |
| InChI | InChI=1S/C6H14N2O2.C3H6N2O/c7-4-2-1-3-5(8)6(9)10;6-3-1-2-4-5-3/h5H,1-4,7-8H2,(H,9,10);4H,1-2H2,(H,5,6)/t5-;/m0./s1 |
| InChIKey | LFTVTYJOHOBJOA-JEDNCBNOSA-N |
| XLogP | -1.46 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|