2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid

C7H12N2O4 — CID 57350456

IUPAC2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid
SMILESNC(CCN1CCC(=O)O1)C(=O)O
InChIInChI=1S/C7H12N2O4/c8-5(7(11)12)1-3-9-4-2-6(10)13-9/h5H,1-4,8H2,(H,11,12)
InChIKeyNYHRSUSPEYSYFX-UHFFFAOYSA-N
MW188.18 g/mol
LogP-1.05
Rot. Bonds4

About 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid

2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid (PubChem CID 57350456) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid.

Molecular Properties

Compound Name2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid
PubChem CID57350456
Molecular FormulaC7H12N2O4
Molecular Weight188.18 g/mol
Exact Mass188.08
IUPAC Name2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid
SMILESNC(CCN1CCC(=O)O1)C(=O)O
InChIInChI=1S/C7H12N2O4/c8-5(7(11)12)1-3-9-4-2-6(10)13-9/h5H,1-4,8H2,(H,11,12)
InChIKeyNYHRSUSPEYSYFX-UHFFFAOYSA-N
XLogP-1.05
TPSA92.86 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.18
LogP ≤ 5-1.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid?
The IUPAC name of 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid (CID 57350456) is 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid.
What is the SMILES notation for 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid?
The canonical SMILES for 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid is NC(CCN1CCC(=O)O1)C(=O)O.
What is the InChIKey of 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid?
The InChIKey is NYHRSUSPEYSYFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4/c8-5(7(11)12)1-3-9-4-2-6(10)13-9/h5H,1-4,8H2,(H,11,12).
What are the key properties of 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid?
2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid has a molecular weight of 188.18 g/mol, XLogP of -1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid is sourced from PubChem (CID 57350456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).