C7H12N2O4 — CID 57350456
2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid (PubChem CID 57350456) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid.
| Compound Name | 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 57350456 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-amino-4-(5-oxo-1,2-oxazolidin-2-yl)butanoic acid |
| SMILES | NC(CCN1CCC(=O)O1)C(=O)O |
| InChI | InChI=1S/C7H12N2O4/c8-5(7(11)12)1-3-9-4-2-6(10)13-9/h5H,1-4,8H2,(H,11,12) |
| InChIKey | NYHRSUSPEYSYFX-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |