C8H10N2O4 — CID 131866140
(2R)-2-amino-4-(2,5-dioxopyrrol-1-yl)butanoic acid (PubChem CID 131866140) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is (2R)-2-amino-4-(2,5-dioxopyrrol-1-yl)butanoic acid.
| Compound Name | (2R)-2-amino-4-(2,5-dioxopyrrol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 131866140 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (2R)-2-amino-4-(2,5-dioxopyrrol-1-yl)butanoic acid |
| SMILES | N[C@H](CCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C8H10N2O4/c9-5(8(13)14)3-4-10-6(11)1-2-7(10)12/h1-2,5H,3-4,9H2,(H,13,14)/t5-/m1/s1 |
| InChIKey | OUYANKKVVJFOQI-RXMQYKEDSA-N |
| XLogP | -1.29 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|