C10H12N2O5 — CID 140634868
2-(aminomethyl)-5-(2,5-dioxopyrrol-1-yl)-3-oxopentanoic acid (PubChem CID 140634868) has the molecular formula C10H12N2O5 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-(aminomethyl)-5-(2,5-dioxopyrrol-1-yl)-3-oxopentanoic acid.
| Compound Name | 2-(aminomethyl)-5-(2,5-dioxopyrrol-1-yl)-3-oxopentanoic acid |
|---|---|
| PubChem CID | 140634868 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(aminomethyl)-5-(2,5-dioxopyrrol-1-yl)-3-oxopentanoic acid |
| SMILES | NCC(C(=O)O)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H12N2O5/c11-5-6(10(16)17)7(13)3-4-12-8(14)1-2-9(12)15/h1-2,6H,3-5,11H2,(H,16,17) |
| InChIKey | WFUSHAUXPHQMMO-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|