C13H15NO6 — CID 66635983
4-[4-(2,5-dioxopyrrol-1-yl)butyl]pent-2-enedioic acid (PubChem CID 66635983) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 4-[4-(2,5-dioxopyrrol-1-yl)butyl]pent-2-enedioic acid.
| Compound Name | 4-[4-(2,5-dioxopyrrol-1-yl)butyl]pent-2-enedioic acid |
|---|---|
| PubChem CID | 66635983 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-[4-(2,5-dioxopyrrol-1-yl)butyl]pent-2-enedioic acid |
| SMILES | O=C(O)C=CC(CCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C13H15NO6/c15-10-5-6-11(16)14(10)8-2-1-3-9(13(19)20)4-7-12(17)18/h4-7,9H,1-3,8H2,(H,17,18)(H,19,20) |
| InChIKey | KILNVLRXRGTDFG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|