C16H25N3O5 — CID 66662829
(4S)-4,8-diamino-2-[4-(2,5-dioxopyrrol-1-yl)butyl]-3-oxooctanoic acid (PubChem CID 66662829) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is (4S)-4,8-diamino-2-[4-(2,5-dioxopyrrol-1-yl)butyl]-3-oxooctanoic acid.
| Compound Name | (4S)-4,8-diamino-2-[4-(2,5-dioxopyrrol-1-yl)butyl]-3-oxooctanoic acid |
|---|---|
| PubChem CID | 66662829 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (4S)-4,8-diamino-2-[4-(2,5-dioxopyrrol-1-yl)butyl]-3-oxooctanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)C(CCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C16H25N3O5/c17-9-3-1-6-12(18)15(22)11(16(23)24)5-2-4-10-19-13(20)7-8-14(19)21/h7-8,11-12H,1-6,9-10,17-18H2,(H,23,24)/t11?,12-/m0/s1 |
| InChIKey | NLBVTDYBRXOPAF-KIYNQFGBSA-N |
| XLogP | -0.19 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|