C38H38N6O15 — CID 159525220
2,6-bis(2,5-dioxopyrrol-1-yl)hexanoic acid;1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione;1-[(2,5-dioxopyrrol-1-yl)methoxymethyl]pyrrole-2,5-dione (PubChem CID 159525220) has the molecular formula C38H38N6O15 and a molecular weight of 818.75 g/mol. Its IUPAC name is 2,6-bis(2,5-dioxopyrrol-1-yl)hexanoic acid;1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione;1-[(2,5-dioxopyrrol-1-yl)methoxymethyl]pyrrole-2,5-dione.
| Compound Name | 2,6-bis(2,5-dioxopyrrol-1-yl)hexanoic acid;1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione;1-[(2,5-dioxopyrrol-1-yl)methoxymethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159525220 |
| Molecular Formula | C38H38N6O15 |
| Molecular Weight | 818.75 g/mol |
| Exact Mass | 818.24 |
| IUPAC Name | 2,6-bis(2,5-dioxopyrrol-1-yl)hexanoic acid;1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione;1-[(2,5-dioxopyrrol-1-yl)methoxymethyl]pyrrole-2,5-dione |
| SMILES | O=C(O)C(CCCCN1C(=O)C=CC1=O)N1C(=O)C=CC1=O.O=C1C=CC(=O)N1CCCCCCN1C(=O)C=CC1=O.O=C1C=CC(=O)N1COCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H14N2O6.C14H16N2O4.C10H8N2O5/c17-10-4-5-11(18)15(10)8-2-1-3-9(14(21)22)16-12(19)6-7-13(16)20;17-11-5-6-12(18)15(11)9-3-1-2-4-10-16-13(19)7-8-14(16)20;13-7-1-2-8(14)11(7)5-17-6-12-9(15)3-4-10(12)16/h4-7,9H,1-3,8H2,(H,21,22);5-8H,1-4,9-10H2;1-4H,5-6H2 |
| InChIKey | MCHKPYZHKQAOHA-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 270.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.75 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|