C13H22N2O4 — CID 142561754
2-(2,5-dioxopyrrol-1-yl)-6-(methylamino)hexanoic acid;ethane (PubChem CID 142561754) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-6-(methylamino)hexanoic acid;ethane.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-6-(methylamino)hexanoic acid;ethane |
|---|---|
| PubChem CID | 142561754 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-6-(methylamino)hexanoic acid;ethane |
| SMILES | CC.CNCCCCC(C(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H16N2O4.C2H6/c1-12-7-3-2-4-8(11(16)17)13-9(14)5-6-10(13)15;1-2/h5-6,8,12H,2-4,7H2,1H3,(H,16,17);1-2H3 |
| InChIKey | USOLMBMGJMDINS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|