C7H8N2O4S2 — CID 138492249
2-(2,5-dioxopyrrol-1-yl)-3-(disulfanylamino)propanoic acid (PubChem CID 138492249) has the molecular formula C7H8N2O4S2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-3-(disulfanylamino)propanoic acid.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-3-(disulfanylamino)propanoic acid |
|---|---|
| PubChem CID | 138492249 |
| Molecular Formula | C7H8N2O4S2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-3-(disulfanylamino)propanoic acid |
| SMILES | O=C(O)C(CNSS)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H8N2O4S2/c10-5-1-2-6(11)9(5)4(7(12)13)3-8-15-14/h1-2,4,8,14H,3H2,(H,12,13) |
| InChIKey | RCUYLZWACLSARJ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|