C10H11NO6 — CID 11687355
dimethyl (2S)-2-(2,5-dioxopyrrol-1-yl)butanedioate (PubChem CID 11687355) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is dimethyl (2S)-2-(2,5-dioxopyrrol-1-yl)butanedioate.
| Compound Name | dimethyl (2S)-2-(2,5-dioxopyrrol-1-yl)butanedioate |
|---|---|
| PubChem CID | 11687355 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | dimethyl (2S)-2-(2,5-dioxopyrrol-1-yl)butanedioate |
| SMILES | COC(=O)C[C@@H](C(=O)OC)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H11NO6/c1-16-9(14)5-6(10(15)17-2)11-7(12)3-4-8(11)13/h3-4,6H,5H2,1-2H3/t6-/m0/s1 |
| InChIKey | RFNGLVKUSRNTRE-LURJTMIESA-N |
| XLogP | -0.98 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|