C17H16N2O4 — CID 162397715
methyl 2-(2,5-dioxopyrrol-1-yl)-3-(1-methylindol-3-yl)propanoate (PubChem CID 162397715) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl 2-(2,5-dioxopyrrol-1-yl)-3-(1-methylindol-3-yl)propanoate.
| Compound Name | methyl 2-(2,5-dioxopyrrol-1-yl)-3-(1-methylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 162397715 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 2-(2,5-dioxopyrrol-1-yl)-3-(1-methylindol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1cn(C)c2ccccc12)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H16N2O4/c1-18-10-11(12-5-3-4-6-13(12)18)9-14(17(22)23-2)19-15(20)7-8-16(19)21/h3-8,10,14H,9H2,1-2H3 |
| InChIKey | LOIBWUYGRVNNAR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|