C15H17NO6 — CID 163895362
dimethyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)butanedioate (PubChem CID 163895362) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is dimethyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)butanedioate.
| Compound Name | dimethyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)butanedioate |
|---|---|
| PubChem CID | 163895362 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | dimethyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)butanedioate |
| SMILES | COC(=O)CC(C(=O)OC)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C15H17NO6/c1-21-10(17)6-9(15(20)22-2)16-13(18)11-7-3-4-8(5-7)12(11)14(16)19/h3-4,7-9,11-12H,5-6H2,1-2H3 |
| InChIKey | QFDHDGIDGOCZNB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|